C12H13N5O2S3 — CID 135475646
5-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carbothioamide (PubChem CID 135475646) has the molecular formula C12H13N5O2S3 and a molecular weight of 355.47 g/mol. Its IUPAC name is 5-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carbothioamide.
| Compound Name | 5-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carbothioamide |
|---|---|
| PubChem CID | 135475646 |
| Molecular Formula | C12H13N5O2S3 |
| Molecular Weight | 355.47 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 5-[(Z)-N'-(4-methylphenyl)sulfonylcarbamimidoyl]-2-sulfanylidene-1,3-dihydroimidazole-4-carbothioamide |
| SMILES | Cc1ccc(S(=O)(=O)/N=C(\N)c2[nH]c(=S)[nH]c2C(N)=S)cc1 |
| InChI | InChI=1S/C12H13N5O2S3/c1-6-2-4-7(5-3-6)22(18,19)17-10(13)8-9(11(14)20)16-12(21)15-8/h2-5H,1H3,(H2,13,17)(H2,14,20)(H2,15,16,21) |
| InChIKey | WXLRGEDHAKPMRC-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.47 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|