C8H12N4O4S — CID 4610108
1-(dihydroxyamino)-2-(4-methylphenyl)sulfonylguanidine (PubChem CID 4610108) has the molecular formula C8H12N4O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is 1-(dihydroxyamino)-2-(4-methylphenyl)sulfonylguanidine.
| Compound Name | 1-(dihydroxyamino)-2-(4-methylphenyl)sulfonylguanidine |
|---|---|
| PubChem CID | 4610108 |
| Molecular Formula | C8H12N4O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.06 |
| IUPAC Name | 1-(dihydroxyamino)-2-(4-methylphenyl)sulfonylguanidine |
| SMILES | Cc1ccc(S(=O)(=O)N=C(N)NN(O)O)cc1 |
| InChI | InChI=1S/C8H12N4O4S/c1-6-2-4-7(5-3-6)17(15,16)11-8(9)10-12(13)14/h2-5,13-14H,1H3,(H3,9,10,11) |
| InChIKey | NNQZUKCMIYJLJN-UHFFFAOYSA-N |
| XLogP | -0.42 |
| TPSA | 128.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|