C17H20N2O2S — CID 154719199
N-(3,5-dimethylphenyl)-N'-(4-methylphenyl)sulfonylethanimidamide (PubChem CID 154719199) has the molecular formula C17H20N2O2S and a molecular weight of 316.43 g/mol. Its IUPAC name is N-(3,5-dimethylphenyl)-N'-(4-methylphenyl)sulfonylethanimidamide.
| Compound Name | N-(3,5-dimethylphenyl)-N'-(4-methylphenyl)sulfonylethanimidamide |
|---|---|
| PubChem CID | 154719199 |
| Molecular Formula | C17H20N2O2S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | N-(3,5-dimethylphenyl)-N'-(4-methylphenyl)sulfonylethanimidamide |
| SMILES | C/C(=N\S(=O)(=O)c1ccc(C)cc1)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H20N2O2S/c1-12-5-7-17(8-6-12)22(20,21)19-15(4)18-16-10-13(2)9-14(3)11-16/h5-11H,1-4H3,(H,18,19) |
| InChIKey | TYRAYAUJWDCMGI-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|