C21H20N2O2S — CID 4030330
2-methyl-N'-(4-methylphenyl)sulfonyl-N-phenylbenzenecarboximidamide (PubChem CID 4030330) has the molecular formula C21H20N2O2S and a molecular weight of 364.47 g/mol. Its IUPAC name is 2-methyl-N'-(4-methylphenyl)sulfonyl-N-phenylbenzenecarboximidamide.
| Compound Name | 2-methyl-N'-(4-methylphenyl)sulfonyl-N-phenylbenzenecarboximidamide |
|---|---|
| PubChem CID | 4030330 |
| Molecular Formula | C21H20N2O2S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 2-methyl-N'-(4-methylphenyl)sulfonyl-N-phenylbenzenecarboximidamide |
| SMILES | Cc1ccc(S(=O)(=O)N=C(Nc2ccccc2)c2ccccc2C)cc1 |
| InChI | InChI=1S/C21H20N2O2S/c1-16-12-14-19(15-13-16)26(24,25)23-21(20-11-7-6-8-17(20)2)22-18-9-4-3-5-10-18/h3-15H,1-2H3,(H,22,23) |
| InChIKey | XARKCHGIRQTRQC-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|