C9H12N2O3S — CID 2794668
N'-hydroxy-2-(4-methylphenyl)sulfonylethanimidamide (PubChem CID 2794668) has the molecular formula C9H12N2O3S and a molecular weight of 228.27 g/mol. Its IUPAC name is N'-hydroxy-2-(4-methylphenyl)sulfonylethanimidamide.
| Compound Name | N'-hydroxy-2-(4-methylphenyl)sulfonylethanimidamide |
|---|---|
| PubChem CID | 2794668 |
| Molecular Formula | C9H12N2O3S |
| Molecular Weight | 228.27 g/mol |
| Exact Mass | 228.06 |
| IUPAC Name | N'-hydroxy-2-(4-methylphenyl)sulfonylethanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)CC(N)=NO)cc1 |
| InChI | InChI=1S/C9H12N2O3S/c1-7-2-4-8(5-3-7)15(13,14)6-9(10)11-12/h2-5,12H,6H2,1H3,(H2,10,11) |
| InChIKey | ZPEOWHYBZZPAEJ-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 92.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.27 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|