C9H12N2O2S2 — CID 15864848
(4-methylphenyl)sulfonylmethylthiourea (PubChem CID 15864848) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is (4-methylphenyl)sulfonylmethylthiourea.
| Compound Name | (4-methylphenyl)sulfonylmethylthiourea |
|---|---|
| PubChem CID | 15864848 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | (4-methylphenyl)sulfonylmethylthiourea |
| SMILES | Cc1ccc(S(=O)(=O)CNC(N)=S)cc1 |
| InChI | InChI=1S/C9H12N2O2S2/c1-7-2-4-8(5-3-7)15(12,13)6-11-9(10)14/h2-5H,6H2,1H3,(H3,10,11,14) |
| InChIKey | RYMZNWRWGNTXJP-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|