C12H17N3O2S2 — CID 2835385
[4-(4-methylphenyl)sulfonylbutan-2-ylideneamino]thiourea (PubChem CID 2835385) has the molecular formula C12H17N3O2S2 and a molecular weight of 299.42 g/mol. Its IUPAC name is [4-(4-methylphenyl)sulfonylbutan-2-ylideneamino]thiourea.
| Compound Name | [4-(4-methylphenyl)sulfonylbutan-2-ylideneamino]thiourea |
|---|---|
| PubChem CID | 2835385 |
| Molecular Formula | C12H17N3O2S2 |
| Molecular Weight | 299.42 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | [4-(4-methylphenyl)sulfonylbutan-2-ylideneamino]thiourea |
| SMILES | CC(CCS(=O)(=O)c1ccc(C)cc1)=NNC(N)=S |
| InChI | InChI=1S/C12H17N3O2S2/c1-9-3-5-11(6-4-9)19(16,17)8-7-10(2)14-15-12(13)18/h3-6H,7-8H2,1-2H3,(H3,13,15,18) |
| InChIKey | HPZNRUOEDZAOFV-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.42 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|