C11H13Cl2N3O2S2 — CID 2835384
[4-(2,5-dichlorophenyl)sulfonylbutan-2-ylideneamino]thiourea (PubChem CID 2835384) has the molecular formula C11H13Cl2N3O2S2 and a molecular weight of 354.28 g/mol. Its IUPAC name is [4-(2,5-dichlorophenyl)sulfonylbutan-2-ylideneamino]thiourea.
| Compound Name | [4-(2,5-dichlorophenyl)sulfonylbutan-2-ylideneamino]thiourea |
|---|---|
| PubChem CID | 2835384 |
| Molecular Formula | C11H13Cl2N3O2S2 |
| Molecular Weight | 354.28 g/mol |
| Exact Mass | 352.98 |
| IUPAC Name | [4-(2,5-dichlorophenyl)sulfonylbutan-2-ylideneamino]thiourea |
| SMILES | CC(CCS(=O)(=O)c1cc(Cl)ccc1Cl)=NNC(N)=S |
| InChI | InChI=1S/C11H13Cl2N3O2S2/c1-7(15-16-11(14)19)4-5-20(17,18)10-6-8(12)2-3-9(10)13/h2-3,6H,4-5H2,1H3,(H3,14,16,19) |
| InChIKey | IJNIAJPHTQSBGZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.28 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|