C11H15Cl2N2O3S+ — CID 8772315
2-(2,5-dichlorophenyl)sulfonylethyl-[2-(methylamino)-2-oxoethyl]azanium (PubChem CID 8772315) has the molecular formula C11H15Cl2N2O3S+ and a molecular weight of 326.23 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)sulfonylethyl-[2-(methylamino)-2-oxoethyl]azanium.
| Compound Name | 2-(2,5-dichlorophenyl)sulfonylethyl-[2-(methylamino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8772315 |
| Molecular Formula | C11H15Cl2N2O3S+ |
| Molecular Weight | 326.23 g/mol |
| Exact Mass | 325.02 |
| IUPAC Name | 2-(2,5-dichlorophenyl)sulfonylethyl-[2-(methylamino)-2-oxoethyl]azanium |
| SMILES | CNC(=O)C[NH2+]CCS(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C11H14Cl2N2O3S/c1-14-11(16)7-15-4-5-19(17,18)10-6-8(12)2-3-9(10)13/h2-3,6,15H,4-5,7H2,1H3,(H,14,16)/p+1 |
| InChIKey | QMMINYNIAWDKKR-UHFFFAOYSA-O |
| XLogP | 0.08 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|