C14H15Cl2NO3S — CID 8920650
(1S)-N-[2-(2,5-dichlorophenyl)sulfonylethyl]-1-(furan-2-yl)ethanamine (PubChem CID 8920650) has the molecular formula C14H15Cl2NO3S and a molecular weight of 348.25 g/mol. Its IUPAC name is (1S)-N-[2-(2,5-dichlorophenyl)sulfonylethyl]-1-(furan-2-yl)ethanamine.
| Compound Name | (1S)-N-[2-(2,5-dichlorophenyl)sulfonylethyl]-1-(furan-2-yl)ethanamine |
|---|---|
| PubChem CID | 8920650 |
| Molecular Formula | C14H15Cl2NO3S |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 347.01 |
| IUPAC Name | (1S)-N-[2-(2,5-dichlorophenyl)sulfonylethyl]-1-(furan-2-yl)ethanamine |
| SMILES | C[C@H](NCCS(=O)(=O)c1cc(Cl)ccc1Cl)c1ccco1 |
| InChI | InChI=1S/C14H15Cl2NO3S/c1-10(13-3-2-7-20-13)17-6-8-21(18,19)14-9-11(15)4-5-12(14)16/h2-5,7,9-10,17H,6,8H2,1H3/t10-/m0/s1 |
| InChIKey | WEYIEVYWOBZAOU-JTQLQIEISA-N |
| XLogP | 3.71 |
| TPSA | 59.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |