C15H19N3O2S3 — CID 54339906
2-(4-methylphenyl)sulfonyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide (PubChem CID 54339906) has the molecular formula C15H19N3O2S3 and a molecular weight of 369.54 g/mol. Its IUPAC name is 2-(4-methylphenyl)sulfonyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide.
| Compound Name | 2-(4-methylphenyl)sulfonyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
|---|---|
| PubChem CID | 54339906 |
| Molecular Formula | C15H19N3O2S3 |
| Molecular Weight | 369.54 g/mol |
| Exact Mass | 369.06 |
| IUPAC Name | 2-(4-methylphenyl)sulfonyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
| SMILES | Cc1ccc(S(=O)(=O)C/C(N)=N/CCSCc2nccs2)cc1 |
| InChI | InChI=1S/C15H19N3O2S3/c1-12-2-4-13(5-3-12)23(19,20)11-14(16)17-6-8-21-10-15-18-7-9-22-15/h2-5,7,9H,6,8,10-11H2,1H3,(H2,16,17) |
| InChIKey | TYEODVPWPKRANP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 85.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.54 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|