C17H17Cl2N3O2S3 — CID 135970844
2-(3,4-dichlorophenyl)sulfonyl-N-prop-2-ynyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide (PubChem CID 135970844) has the molecular formula C17H17Cl2N3O2S3 and a molecular weight of 462.45 g/mol. Its IUPAC name is 2-(3,4-dichlorophenyl)sulfonyl-N-prop-2-ynyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide.
| Compound Name | 2-(3,4-dichlorophenyl)sulfonyl-N-prop-2-ynyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
|---|---|
| PubChem CID | 135970844 |
| Molecular Formula | C17H17Cl2N3O2S3 |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 460.99 |
| IUPAC Name | 2-(3,4-dichlorophenyl)sulfonyl-N-prop-2-ynyl-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
| SMILES | C#CCN/C(CS(=O)(=O)c1ccc(Cl)c(Cl)c1)=N\CCSCc1nccs1 |
| InChI | InChI=1S/C17H17Cl2N3O2S3/c1-2-5-20-16(21-6-8-25-11-17-22-7-9-26-17)12-27(23,24)13-3-4-14(18)15(19)10-13/h1,3-4,7,9-10H,5-6,8,11-12H2,(H,20,21) |
| InChIKey | CBFGGENQGYGGJR-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|