C12H15N5S2 — CID 54304952
2-but-3-ynyl-1-cyano-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 54304952) has the molecular formula C12H15N5S2 and a molecular weight of 293.42 g/mol. Its IUPAC name is 2-but-3-ynyl-1-cyano-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 2-but-3-ynyl-1-cyano-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 54304952 |
| Molecular Formula | C12H15N5S2 |
| Molecular Weight | 293.42 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 2-but-3-ynyl-1-cyano-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | C#CCC/N=C(\NC#N)NCCSCc1nccs1 |
| InChI | InChI=1S/C12H15N5S2/c1-2-3-4-15-12(17-10-13)16-5-7-18-9-11-14-6-8-19-11/h1,6,8H,3-5,7,9H2,(H2,15,16,17) |
| InChIKey | SGVKBDDGCZEZGL-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.42 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|