C13H19N5OS — CID 110182152
1-cyano-2-(3-hydroxypropyl)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 110182152) has the molecular formula C13H19N5OS and a molecular weight of 293.40 g/mol. Its IUPAC name is 1-cyano-2-(3-hydroxypropyl)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]guanidine.
| Compound Name | 1-cyano-2-(3-hydroxypropyl)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]guanidine |
|---|---|
| PubChem CID | 110182152 |
| Molecular Formula | C13H19N5OS |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.13 |
| IUPAC Name | 1-cyano-2-(3-hydroxypropyl)-3-[2-(pyridin-2-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | N#CN/C(=N\CCCO)NCCSCc1ccccn1 |
| InChI | InChI=1S/C13H19N5OS/c14-11-18-13(16-6-3-8-19)17-7-9-20-10-12-4-1-2-5-15-12/h1-2,4-5,19H,3,6-10H2,(H2,16,17,18) |
| InChIKey | IXNQUTPCXAUCCB-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 93.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|