C18H19ClN6S3 — CID 54115598
N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2,2-dicyano-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide (PubChem CID 54115598) has the molecular formula C18H19ClN6S3 and a molecular weight of 451.05 g/mol. Its IUPAC name is N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2,2-dicyano-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide.
| Compound Name | N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2,2-dicyano-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
|---|---|
| PubChem CID | 54115598 |
| Molecular Formula | C18H19ClN6S3 |
| Molecular Weight | 451.05 g/mol |
| Exact Mass | 450.05 |
| IUPAC Name | N-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]-2,2-dicyano-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
| SMILES | N#CC(C#N)/C(=N\CCSCc1nccs1)NCCSCc1ncccc1Cl |
| InChI | InChI=1S/C18H19ClN6S3/c19-15-2-1-3-22-16(15)12-26-7-4-24-18(14(10-20)11-21)25-5-8-27-13-17-23-6-9-28-17/h1-3,6,9,14H,4-5,7-8,12-13H2,(H,24,25) |
| InChIKey | NKCXVMLMSHRHBC-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 97.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.05 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|