C14H21ClN8S — CID 54216108
1-[2-[[N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-cyano-2-methylguanidine (PubChem CID 54216108) has the molecular formula C14H21ClN8S and a molecular weight of 368.90 g/mol. Its IUPAC name is 1-[2-[[N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-cyano-2-methylguanidine.
| Compound Name | 1-[2-[[N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-cyano-2-methylguanidine |
|---|---|
| PubChem CID | 54216108 |
| Molecular Formula | C14H21ClN8S |
| Molecular Weight | 368.90 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 1-[2-[[N'-[2-[(3-chloro-2-pyridinyl)methylsulfanyl]ethyl]carbamimidoyl]amino]ethyl]-3-cyano-2-methylguanidine |
| SMILES | C/N=C(\NC#N)NCCN/C(N)=N/CCSCc1ncccc1Cl |
| InChI | InChI=1S/C14H21ClN8S/c1-18-14(23-10-16)22-6-5-20-13(17)21-7-8-24-9-12-11(15)3-2-4-19-12/h2-4H,5-9H2,1H3,(H3,17,20,21)(H2,18,22,23) |
| InChIKey | PZHCFVWYXYAPQK-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 123.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.90 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|