C15H22N6O2S3 — CID 54003257
N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide (PubChem CID 54003257) has the molecular formula C15H22N6O2S3 and a molecular weight of 414.58 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide.
| Compound Name | N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
|---|---|
| PubChem CID | 54003257 |
| Molecular Formula | C15H22N6O2S3 |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.10 |
| IUPAC Name | N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]ethanimidamide |
| SMILES | Cc1[nH]cnc1CSCCN/C(C[N+](=O)[O-])=N/CCSCc1nccs1 |
| InChI | InChI=1S/C15H22N6O2S3/c1-12-13(20-11-19-12)9-24-5-2-16-14(8-21(22)23)17-3-6-25-10-15-18-4-7-26-15/h4,7,11H,2-3,5-6,8-10H2,1H3,(H,16,17)(H,19,20) |
| InChIKey | KNCGFWCJGYDGMX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 109.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|