C11H16F3N5O2S — CID 54134502
N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide (PubChem CID 54134502) has the molecular formula C11H16F3N5O2S and a molecular weight of 339.34 g/mol. Its IUPAC name is N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide.
| Compound Name | N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide |
|---|---|
| PubChem CID | 54134502 |
| Molecular Formula | C11H16F3N5O2S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.10 |
| IUPAC Name | N-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]-2-nitro-N'-(2,2,2-trifluoroethyl)ethanimidamide |
| SMILES | Cc1[nH]cnc1CSCCN/C(C[N+](=O)[O-])=N/CC(F)(F)F |
| InChI | InChI=1S/C11H16F3N5O2S/c1-8-9(18-7-17-8)5-22-3-2-15-10(4-19(20)21)16-6-11(12,13)14/h7H,2-6H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | NWSJBYGMQORJQW-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 96.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|