C14H26Cl3N7S — CID 3068226
2-(3-imidazol-1-ylpropyl)-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine;trihydrochloride (PubChem CID 3068226) has the molecular formula C14H26Cl3N7S and a molecular weight of 430.84 g/mol. Its IUPAC name is 2-(3-imidazol-1-ylpropyl)-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine;trihydrochloride.
| Compound Name | 2-(3-imidazol-1-ylpropyl)-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine;trihydrochloride |
|---|---|
| PubChem CID | 3068226 |
| Molecular Formula | C14H26Cl3N7S |
| Molecular Weight | 430.84 g/mol |
| Exact Mass | 429.10 |
| IUPAC Name | 2-(3-imidazol-1-ylpropyl)-1-[2-[(5-methyl-1H-imidazol-4-yl)methylsulfanyl]ethyl]guanidine;trihydrochloride |
| SMILES | Cc1[nH]cnc1CSCCN/C(N)=N/CCCn1ccnc1.Cl.Cl.Cl |
| InChI | InChI=1S/C14H23N7S.3ClH/c1-12-13(20-10-19-12)9-22-8-5-18-14(15)17-3-2-6-21-7-4-16-11-21;;;/h4,7,10-11H,2-3,5-6,8-9H2,1H3,(H,19,20)(H3,15,17,18);3*1H |
| InChIKey | PVKKINGYZUPNRF-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 96.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.84 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imidazole_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|