C11H22IN5 — CID 110912123
1-(3-imidazol-1-ylpropyl)-2-(2-methylpropyl)guanidine;hydroiodide (PubChem CID 110912123) has the molecular formula C11H22IN5 and a molecular weight of 351.24 g/mol. Its IUPAC name is 1-(3-imidazol-1-ylpropyl)-2-(2-methylpropyl)guanidine;hydroiodide.
| Compound Name | 1-(3-imidazol-1-ylpropyl)-2-(2-methylpropyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110912123 |
| Molecular Formula | C11H22IN5 |
| Molecular Weight | 351.24 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | 1-(3-imidazol-1-ylpropyl)-2-(2-methylpropyl)guanidine;hydroiodide |
| SMILES | CC(C)C/N=C(\N)NCCCn1ccnc1.I |
| InChI | InChI=1S/C11H21N5.HI/c1-10(2)8-15-11(12)14-4-3-6-16-7-5-13-9-16;/h5,7,9-10H,3-4,6,8H2,1-2H3,(H3,12,14,15);1H |
| InChIKey | RJXGEGRSJUWNKF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.24 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|