C23H36N8O2S2 — CID 20508668
2-[3-[[amino-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-1-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethyl]guanidine (PubChem CID 20508668) has the molecular formula C23H36N8O2S2 and a molecular weight of 520.73 g/mol. Its IUPAC name is 2-[3-[[amino-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-1-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethyl]guanidine.
| Compound Name | 2-[3-[[amino-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-1-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 20508668 |
| Molecular Formula | C23H36N8O2S2 |
| Molecular Weight | 520.73 g/mol |
| Exact Mass | 520.24 |
| IUPAC Name | 2-[3-[[amino-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]methylidene]amino]propyl]-1-[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethyl]guanidine |
| SMILES | COc1cccnc1CSCCN/C(N)=N/CCC/N=C(\N)NCCSCc1ncccc1OC |
| InChI | InChI=1S/C23H36N8O2S2/c1-32-20-6-3-8-26-18(20)16-34-14-12-30-22(24)28-10-5-11-29-23(25)31-13-15-35-17-19-21(33-2)7-4-9-27-19/h3-4,6-9H,5,10-17H2,1-2H3,(H3,24,28,30)(H3,25,29,31) |
| InChIKey | BIHNDDPZBWPQNA-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 145.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.73 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|