C11H17N3O4S2 — CID 20507766
[2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid (PubChem CID 20507766) has the molecular formula C11H17N3O4S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is [2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid.
| Compound Name | [2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid |
|---|---|
| PubChem CID | 20507766 |
| Molecular Formula | C11H17N3O4S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.07 |
| IUPAC Name | [2-[(3-methoxy-2-pyridinyl)methylsulfanyl]ethylamino]-methyliminomethanesulfonic acid |
| SMILES | C/N=C(\NCCSCc1ncccc1OC)S(=O)(=O)O |
| InChI | InChI=1S/C11H17N3O4S2/c1-12-11(20(15,16)17)14-6-7-19-8-9-10(18-2)4-3-5-13-9/h3-5H,6-8H2,1-2H3,(H,12,14)(H,15,16,17) |
| InChIKey | AIJSLULXCYQFHV-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|