C9H12N2O2S2 — CID 68732491
2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylcarbamic acid (PubChem CID 68732491) has the molecular formula C9H12N2O2S2 and a molecular weight of 244.34 g/mol. Its IUPAC name is 2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylcarbamic acid.
| Compound Name | 2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylcarbamic acid |
|---|---|
| PubChem CID | 68732491 |
| Molecular Formula | C9H12N2O2S2 |
| Molecular Weight | 244.34 g/mol |
| Exact Mass | 244.03 |
| IUPAC Name | 2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylcarbamic acid |
| SMILES | O=C(O)NCCSCc1ncccc1S |
| InChI | InChI=1S/C9H12N2O2S2/c12-9(13)11-4-5-15-6-7-8(14)2-1-3-10-7/h1-3,11,14H,4-6H2,(H,12,13) |
| InChIKey | MQRGTPBUZFIXKP-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|