C12H19Cl2N3O3S2 — CID 20720675
(3S)-3-amino-4-oxo-4-[2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylamino]butanoic acid;dihydrochloride (PubChem CID 20720675) has the molecular formula C12H19Cl2N3O3S2 and a molecular weight of 388.34 g/mol. Its IUPAC name is (3S)-3-amino-4-oxo-4-[2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylamino]butanoic acid;dihydrochloride.
| Compound Name | (3S)-3-amino-4-oxo-4-[2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylamino]butanoic acid;dihydrochloride |
|---|---|
| PubChem CID | 20720675 |
| Molecular Formula | C12H19Cl2N3O3S2 |
| Molecular Weight | 388.34 g/mol |
| Exact Mass | 387.02 |
| IUPAC Name | (3S)-3-amino-4-oxo-4-[2-[(3-sulfanyl-2-pyridinyl)methylsulfanyl]ethylamino]butanoic acid;dihydrochloride |
| SMILES | Cl.Cl.N[C@@H](CC(=O)O)C(=O)NCCSCc1ncccc1S |
| InChI | InChI=1S/C12H17N3O3S2.2ClH/c13-8(6-11(16)17)12(18)15-4-5-20-7-9-10(19)2-1-3-14-9;;/h1-3,8,19H,4-7,13H2,(H,15,18)(H,16,17);2*1H/t8-;;/m0../s1 |
| InChIKey | XMCIVRKVOBFGAN-JZGIKJSDSA-N |
| XLogP | 1.37 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.34 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|