C18H25ClN2OS — CID 119304338
2-amino-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]pentanamide;hydrochloride (PubChem CID 119304338) has the molecular formula C18H25ClN2OS and a molecular weight of 352.93 g/mol. Its IUPAC name is 2-amino-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]pentanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]pentanamide;hydrochloride |
|---|---|
| PubChem CID | 119304338 |
| Molecular Formula | C18H25ClN2OS |
| Molecular Weight | 352.93 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-amino-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]pentanamide;hydrochloride |
| SMILES | CCCC(N)C(=O)NCCSCc1cccc2ccccc12.Cl |
| InChI | InChI=1S/C18H24N2OS.ClH/c1-2-6-17(19)18(21)20-11-12-22-13-15-9-5-8-14-7-3-4-10-16(14)15;/h3-5,7-10,17H,2,6,11-13,19H2,1H3,(H,20,21);1H |
| InChIKey | SHIQLMMSYRWNAK-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.93 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|