C18H24N2OS2 — CID 119304331
(2S)-2-amino-4-methylsulfanyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]butanamide (PubChem CID 119304331) has the molecular formula C18H24N2OS2 and a molecular weight of 348.54 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]butanamide.
| Compound Name | (2S)-2-amino-4-methylsulfanyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]butanamide |
|---|---|
| PubChem CID | 119304331 |
| Molecular Formula | C18H24N2OS2 |
| Molecular Weight | 348.54 g/mol |
| Exact Mass | 348.13 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanyl-N-[2-(naphthalen-1-ylmethylsulfanyl)ethyl]butanamide |
| SMILES | CSCC[C@H](N)C(=O)NCCSCc1cccc2ccccc12 |
| InChI | InChI=1S/C18H24N2OS2/c1-22-11-9-17(19)18(21)20-10-12-23-13-15-7-4-6-14-5-2-3-8-16(14)15/h2-8,17H,9-13,19H2,1H3,(H,20,21)/t17-/m0/s1 |
| InChIKey | ALTWYXPMAIORNA-KRWDZBQOSA-N |
| XLogP | 3.27 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|