C18H24N2O4S — CID 161034514
(2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-amino-3-naphthalen-1-ylpropanoic acid (PubChem CID 161034514) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-amino-3-naphthalen-1-ylpropanoic acid.
| Compound Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-amino-3-naphthalen-1-ylpropanoic acid |
|---|---|
| PubChem CID | 161034514 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2S)-2-amino-4-methylsulfanylbutanoic acid;(2S)-2-amino-3-naphthalen-1-ylpropanoic acid |
| SMILES | CSCC[C@H](N)C(=O)O.N[C@@H](Cc1cccc2ccccc12)C(=O)O |
| InChI | InChI=1S/C13H13NO2.C5H11NO2S/c14-12(13(15)16)8-10-6-3-5-9-4-1-2-7-11(9)10;1-9-3-2-4(6)5(7)8/h1-7,12H,8,14H2,(H,15,16);4H,2-3,6H2,1H3,(H,7,8)/t12-;4-/m00/s1 |
| InChIKey | UABONJRNPXQJDW-GOYLBZKJSA-N |
| XLogP | 1.95 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |