C14H22ClFN2O3S2 — CID 119956122
2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-methylsulfonylbutanamide;hydrochloride (PubChem CID 119956122) has the molecular formula C14H22ClFN2O3S2 and a molecular weight of 384.93 g/mol. Its IUPAC name is 2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-methylsulfonylbutanamide;hydrochloride.
| Compound Name | 2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-methylsulfonylbutanamide;hydrochloride |
|---|---|
| PubChem CID | 119956122 |
| Molecular Formula | C14H22ClFN2O3S2 |
| Molecular Weight | 384.93 g/mol |
| Exact Mass | 384.07 |
| IUPAC Name | 2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-4-methylsulfonylbutanamide;hydrochloride |
| SMILES | CS(=O)(=O)CCC(N)C(=O)NCCSCc1ccccc1F.Cl |
| InChI | InChI=1S/C14H21FN2O3S2.ClH/c1-22(19,20)9-6-13(16)14(18)17-7-8-21-10-11-4-2-3-5-12(11)15;/h2-5,13H,6-10,16H2,1H3,(H,17,18);1H |
| InChIKey | SDQDJSOFDAFCPF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.93 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|