C18H22ClFN2OS — CID 120666770
2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride (PubChem CID 120666770) has the molecular formula C18H22ClFN2OS and a molecular weight of 368.91 g/mol. Its IUPAC name is 2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride.
| Compound Name | 2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride |
|---|---|
| PubChem CID | 120666770 |
| Molecular Formula | C18H22ClFN2OS |
| Molecular Weight | 368.91 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 2-amino-N-[2-[(2-fluorophenyl)methylsulfanyl]ethyl]-2-(4-methylphenyl)acetamide;hydrochloride |
| SMILES | Cc1ccc(C(N)C(=O)NCCSCc2ccccc2F)cc1.Cl |
| InChI | InChI=1S/C18H21FN2OS.ClH/c1-13-6-8-14(9-7-13)17(20)18(22)21-10-11-23-12-15-4-2-3-5-16(15)19;/h2-9,17H,10-12,20H2,1H3,(H,21,22);1H |
| InChIKey | QDWBVQYJFZLPEE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.91 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|