C22H31N3O2S4 — CID 58430351
tert-butyl N-[2-[[3-[[2-(propylsulfanylmethyl)-3-pyridinyl]disulfanyl]-2-pyridinyl]methylsulfanyl]ethyl]carbamate (PubChem CID 58430351) has the molecular formula C22H31N3O2S4 and a molecular weight of 497.78 g/mol. Its IUPAC name is tert-butyl N-[2-[[3-[[2-(propylsulfanylmethyl)-3-pyridinyl]disulfanyl]-2-pyridinyl]methylsulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[3-[[2-(propylsulfanylmethyl)-3-pyridinyl]disulfanyl]-2-pyridinyl]methylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 58430351 |
| Molecular Formula | C22H31N3O2S4 |
| Molecular Weight | 497.78 g/mol |
| Exact Mass | 497.13 |
| IUPAC Name | tert-butyl N-[2-[[3-[[2-(propylsulfanylmethyl)-3-pyridinyl]disulfanyl]-2-pyridinyl]methylsulfanyl]ethyl]carbamate |
| SMILES | CCCSCc1ncccc1SSc1cccnc1CSCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H31N3O2S4/c1-5-13-28-15-17-19(8-6-10-23-17)30-31-20-9-7-11-24-18(20)16-29-14-12-25-21(26)27-22(2,3)4/h6-11H,5,12-16H2,1-4H3,(H,25,26) |
| InChIKey | GFTIKWFFYKGJAO-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.78 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|