C17H27N3O4S — CID 84561111
tert-butyl N-[2-[2-oxo-2-[(3-propoxy-2-pyridinyl)amino]ethyl]sulfanylethyl]carbamate (PubChem CID 84561111) has the molecular formula C17H27N3O4S and a molecular weight of 369.49 g/mol. Its IUPAC name is tert-butyl N-[2-[2-oxo-2-[(3-propoxy-2-pyridinyl)amino]ethyl]sulfanylethyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-oxo-2-[(3-propoxy-2-pyridinyl)amino]ethyl]sulfanylethyl]carbamate |
|---|---|
| PubChem CID | 84561111 |
| Molecular Formula | C17H27N3O4S |
| Molecular Weight | 369.49 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | tert-butyl N-[2-[2-oxo-2-[(3-propoxy-2-pyridinyl)amino]ethyl]sulfanylethyl]carbamate |
| SMILES | CCCOc1cccnc1NC(=O)CSCCNC(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H27N3O4S/c1-5-10-23-13-7-6-8-18-15(13)20-14(21)12-25-11-9-19-16(22)24-17(2,3)4/h6-8H,5,9-12H2,1-4H3,(H,19,22)(H,18,20,21) |
| InChIKey | RFIUJCJECQYLTM-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.49 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|