C12H19N3O2S — CID 84561073
2-(2-aminoethylsulfanyl)-N-(3-propoxy-2-pyridinyl)acetamide (PubChem CID 84561073) has the molecular formula C12H19N3O2S and a molecular weight of 269.37 g/mol. Its IUPAC name is 2-(2-aminoethylsulfanyl)-N-(3-propoxy-2-pyridinyl)acetamide.
| Compound Name | 2-(2-aminoethylsulfanyl)-N-(3-propoxy-2-pyridinyl)acetamide |
|---|---|
| PubChem CID | 84561073 |
| Molecular Formula | C12H19N3O2S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(2-aminoethylsulfanyl)-N-(3-propoxy-2-pyridinyl)acetamide |
| SMILES | CCCOc1cccnc1NC(=O)CSCCN |
| InChI | InChI=1S/C12H19N3O2S/c1-2-7-17-10-4-3-6-14-12(10)15-11(16)9-18-8-5-13/h3-4,6H,2,5,7-9,13H2,1H3,(H,14,15,16) |
| InChIKey | DMWZBXOUAZUHHM-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 77.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|