C32H36N2O2S2 — CID 22726828
tert-butyl carbamate;2-(ethylsulfanylmethyl)-3-tritylsulfanylpyridine (PubChem CID 22726828) has the molecular formula C32H36N2O2S2 and a molecular weight of 544.79 g/mol. Its IUPAC name is tert-butyl carbamate;2-(ethylsulfanylmethyl)-3-tritylsulfanylpyridine.
| Compound Name | tert-butyl carbamate;2-(ethylsulfanylmethyl)-3-tritylsulfanylpyridine |
|---|---|
| PubChem CID | 22726828 |
| Molecular Formula | C32H36N2O2S2 |
| Molecular Weight | 544.79 g/mol |
| Exact Mass | 544.22 |
| IUPAC Name | tert-butyl carbamate;2-(ethylsulfanylmethyl)-3-tritylsulfanylpyridine |
| SMILES | CC(C)(C)OC(N)=O.CCSCc1ncccc1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H25NS2.C5H11NO2/c1-2-29-21-25-26(19-12-20-28-25)30-27(22-13-6-3-7-14-22,23-15-8-4-9-16-23)24-17-10-5-11-18-24;1-5(2,3)8-4(6)7/h3-20H,2,21H2,1H3;1-3H3,(H2,6,7) |
| InChIKey | LOJOFSQNEZBOBK-UHFFFAOYSA-N |
| XLogP | 8.30 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.79 |
| LogP ≤ 5 | 8.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|