C32H34N2O2S2 — CID 54025988
tert-butyl N-[2-[(3-tritylsulfanyl-4-pyridinyl)methylsulfanyl]ethyl]carbamate (PubChem CID 54025988) has the molecular formula C32H34N2O2S2 and a molecular weight of 542.77 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-tritylsulfanyl-4-pyridinyl)methylsulfanyl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[(3-tritylsulfanyl-4-pyridinyl)methylsulfanyl]ethyl]carbamate |
|---|---|
| PubChem CID | 54025988 |
| Molecular Formula | C32H34N2O2S2 |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.21 |
| IUPAC Name | tert-butyl N-[2-[(3-tritylsulfanyl-4-pyridinyl)methylsulfanyl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCSCc1ccncc1SC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H34N2O2S2/c1-31(2,3)36-30(35)34-21-22-37-24-25-19-20-33-23-29(25)38-32(26-13-7-4-8-14-26,27-15-9-5-10-16-27)28-17-11-6-12-18-28/h4-20,23H,21-22,24H2,1-3H3,(H,34,35) |
| InChIKey | LCFDPLSHAIRULO-UHFFFAOYSA-N |
| XLogP | 7.92 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 7.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|