C10H17N5O3S2 — CID 54257613
1-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-methyl-3-sulfamoylguanidine (PubChem CID 54257613) has the molecular formula C10H17N5O3S2 and a molecular weight of 319.41 g/mol. Its IUPAC name is 1-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-methyl-3-sulfamoylguanidine.
| Compound Name | 1-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-methyl-3-sulfamoylguanidine |
|---|---|
| PubChem CID | 54257613 |
| Molecular Formula | C10H17N5O3S2 |
| Molecular Weight | 319.41 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-[2-[(3-hydroxy-2-pyridinyl)methylsulfanyl]ethyl]-2-methyl-3-sulfamoylguanidine |
| SMILES | C/N=C(\NCCSCc1ncccc1O)NS(N)(=O)=O |
| InChI | InChI=1S/C10H17N5O3S2/c1-12-10(15-20(11,17)18)14-5-6-19-7-8-9(16)3-2-4-13-8/h2-4,16H,5-7H2,1H3,(H2,11,17,18)(H2,12,14,15) |
| InChIKey | RBEPZMJFWRXOAY-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 129.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.41 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|