C19H20BrN3O2S2 — CID 88768827
2-(benzenesulfonyl)-1-N-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine (PubChem CID 88768827) has the molecular formula C19H20BrN3O2S2 and a molecular weight of 466.43 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-1-N-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine.
| Compound Name | 2-(benzenesulfonyl)-1-N-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine |
|---|---|
| PubChem CID | 88768827 |
| Molecular Formula | C19H20BrN3O2S2 |
| Molecular Weight | 466.43 g/mol |
| Exact Mass | 465.02 |
| IUPAC Name | 2-(benzenesulfonyl)-1-N-[2-[(3-bromo-2-pyridinyl)methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine |
| SMILES | C#CCNC(=CS(=O)(=O)c1ccccc1)NCCSCc1ncccc1Br |
| InChI | InChI=1S/C19H20BrN3O2S2/c1-2-10-22-19(15-27(24,25)16-7-4-3-5-8-16)23-12-13-26-14-18-17(20)9-6-11-21-18/h1,3-9,11,15,22-23H,10,12-14H2 |
| InChIKey | IXUMOEZYJYTNPL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.43 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|