C21H26ClN3O3S2 — CID 88782634
2-(4-chlorophenyl)sulfonyl-1-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine (PubChem CID 88782634) has the molecular formula C21H26ClN3O3S2 and a molecular weight of 468.04 g/mol. Its IUPAC name is 2-(4-chlorophenyl)sulfonyl-1-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine.
| Compound Name | 2-(4-chlorophenyl)sulfonyl-1-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine |
|---|---|
| PubChem CID | 88782634 |
| Molecular Formula | C21H26ClN3O3S2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 2-(4-chlorophenyl)sulfonyl-1-N-[2-[[5-[(dimethylamino)methyl]furan-2-yl]methylsulfanyl]ethyl]-1-N'-prop-2-ynylethene-1,1-diamine |
| SMILES | C#CCNC(=CS(=O)(=O)c1ccc(Cl)cc1)NCCSCc1ccc(CN(C)C)o1 |
| InChI | InChI=1S/C21H26ClN3O3S2/c1-4-11-23-21(16-30(26,27)20-9-5-17(22)6-10-20)24-12-13-29-15-19-8-7-18(28-19)14-25(2)3/h1,5-10,16,23-24H,11-15H2,2-3H3 |
| InChIKey | UPHXKCBGRIJPJY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 74.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|