C12H20F3N7O2S3 — CID 21298797
2-methyl-1-methylsulfonyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine (PubChem CID 21298797) has the molecular formula C12H20F3N7O2S3 and a molecular weight of 447.53 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine.
| Compound Name | 2-methyl-1-methylsulfonyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
|---|---|
| PubChem CID | 21298797 |
| Molecular Formula | C12H20F3N7O2S3 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.08 |
| IUPAC Name | 2-methyl-1-methylsulfonyl-3-[2-[[2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]guanidine |
| SMILES | C/N=C(/NCCSCc1csc(N/C(N)=N/CC(F)(F)F)n1)NS(C)(=O)=O |
| InChI | InChI=1S/C12H20F3N7O2S3/c1-17-10(22-27(2,23)24)18-3-4-25-5-8-6-26-11(20-8)21-9(16)19-7-12(13,14)15/h6H,3-5,7H2,1-2H3,(H2,17,18,22)(H3,16,19,20,21) |
| InChIKey | GUUYIHFWXYHIOM-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|