C9H14F3N5S2 — CID 14182086
1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine (PubChem CID 14182086) has the molecular formula C9H14F3N5S2 and a molecular weight of 313.37 g/mol. Its IUPAC name is 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine.
| Compound Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
|---|---|
| PubChem CID | 14182086 |
| Molecular Formula | C9H14F3N5S2 |
| Molecular Weight | 313.37 g/mol |
| Exact Mass | 313.06 |
| IUPAC Name | 1-[4-(2-aminoethylsulfanylmethyl)-1,3-thiazol-2-yl]-2-(2,2,2-trifluoroethyl)guanidine |
| SMILES | NCCSCc1csc(N/C(N)=N/CC(F)(F)F)n1 |
| InChI | InChI=1S/C9H14F3N5S2/c10-9(11,12)5-15-7(14)17-8-16-6(4-19-8)3-18-2-1-13/h4H,1-3,5,13H2,(H3,14,15,16,17) |
| InChIKey | NWKIODFPRAEIBS-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.37 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|