C12H21F2N7O2S3 — CID 21298867
1-[2-[[2-[[N'-(2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-methylsulfonylguanidine (PubChem CID 21298867) has the molecular formula C12H21F2N7O2S3 and a molecular weight of 429.54 g/mol. Its IUPAC name is 1-[2-[[2-[[N'-(2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-methylsulfonylguanidine.
| Compound Name | 1-[2-[[2-[[N'-(2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-methylsulfonylguanidine |
|---|---|
| PubChem CID | 21298867 |
| Molecular Formula | C12H21F2N7O2S3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.09 |
| IUPAC Name | 1-[2-[[2-[[N'-(2,2-difluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]methylsulfanyl]ethyl]-2-methyl-3-methylsulfonylguanidine |
| SMILES | C/N=C(/NCCSCc1csc(N/C(N)=N/CC(F)F)n1)NS(C)(=O)=O |
| InChI | InChI=1S/C12H21F2N7O2S3/c1-16-11(21-26(2,22)23)17-3-4-24-6-8-7-25-12(19-8)20-10(15)18-5-9(13)14/h7,9H,3-6H2,1-2H3,(H2,16,17,21)(H3,15,18,19,20) |
| InChIKey | LSPGBSJNMUHNIY-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|