C14H24F3N7O2S2 — CID 21298862
2-methyl-1-methylsulfonyl-3-[4-[5-methyl-2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]guanidine (PubChem CID 21298862) has the molecular formula C14H24F3N7O2S2 and a molecular weight of 443.52 g/mol. Its IUPAC name is 2-methyl-1-methylsulfonyl-3-[4-[5-methyl-2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]guanidine.
| Compound Name | 2-methyl-1-methylsulfonyl-3-[4-[5-methyl-2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]guanidine |
|---|---|
| PubChem CID | 21298862 |
| Molecular Formula | C14H24F3N7O2S2 |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | 2-methyl-1-methylsulfonyl-3-[4-[5-methyl-2-[[N'-(2,2,2-trifluoroethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]guanidine |
| SMILES | C/N=C(/NCCCCc1nc(N/C(N)=N/CC(F)(F)F)sc1C)NS(C)(=O)=O |
| InChI | InChI=1S/C14H24F3N7O2S2/c1-9-10(6-4-5-7-20-12(19-2)24-28(3,25)26)22-13(27-9)23-11(18)21-8-14(15,16)17/h4-8H2,1-3H3,(H2,19,20,24)(H3,18,21,22,23) |
| InChIKey | SYNVNUNAIGNIRK-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 133.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|