C11H16N8O2S3 — CID 18953912
1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methyl-3-methylsulfonylguanidine (PubChem CID 18953912) has the molecular formula C11H16N8O2S3 and a molecular weight of 388.50 g/mol. Its IUPAC name is 1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methyl-3-methylsulfonylguanidine.
| Compound Name | 1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methyl-3-methylsulfonylguanidine |
|---|---|
| PubChem CID | 18953912 |
| Molecular Formula | C11H16N8O2S3 |
| Molecular Weight | 388.50 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 1-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-2-methyl-3-methylsulfonylguanidine |
| SMILES | C/N=C(/NCc1nc(-c2csc(N=C(N)N)n2)cs1)NS(C)(=O)=O |
| InChI | InChI=1S/C11H16N8O2S3/c1-14-10(19-24(2,20)21)15-3-8-16-6(4-22-8)7-5-23-11(17-7)18-9(12)13/h4-5H,3H2,1-2H3,(H2,14,15,19)(H4,12,13,17,18) |
| InChIKey | QGQQFKDOWBPFSF-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 160.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.50 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|