C11H15N7O2S3 — CID 18953819
N'-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-N-ethylsulfonylmethanimidamide (PubChem CID 18953819) has the molecular formula C11H15N7O2S3 and a molecular weight of 373.49 g/mol. Its IUPAC name is N'-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-N-ethylsulfonylmethanimidamide.
| Compound Name | N'-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-N-ethylsulfonylmethanimidamide |
|---|---|
| PubChem CID | 18953819 |
| Molecular Formula | C11H15N7O2S3 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | N'-[[4-[2-(diaminomethylideneamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]methyl]-N-ethylsulfonylmethanimidamide |
| SMILES | CCS(=O)(=O)N/C=N/Cc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C11H15N7O2S3/c1-2-23(19,20)15-6-14-3-9-16-7(4-21-9)8-5-22-11(17-8)18-10(12)13/h4-6H,2-3H2,1H3,(H,14,15)(H4,12,13,17,18) |
| InChIKey | XONDYMGQTAHSMG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|