C8H10N6S2 — CID 13100988
2-[4-[2-(methylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine (PubChem CID 13100988) has the molecular formula C8H10N6S2 and a molecular weight of 254.34 g/mol. Its IUPAC name is 2-[4-[2-(methylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine.
| Compound Name | 2-[4-[2-(methylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine |
|---|---|
| PubChem CID | 13100988 |
| Molecular Formula | C8H10N6S2 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-[4-[2-(methylamino)-1,3-thiazol-4-yl]-1,3-thiazol-2-yl]guanidine |
| SMILES | CNc1nc(-c2csc(N=C(N)N)n2)cs1 |
| InChI | InChI=1S/C8H10N6S2/c1-11-7-12-4(2-15-7)5-3-16-8(13-5)14-6(9)10/h2-3H,1H3,(H,11,12)(H4,9,10,13,14) |
| InChIKey | JKOLSKZUIFOGPA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|