C18H31N7O7S2 — CID 88701159
(Z)-but-2-enedioic acid;1-[4-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]-2-methyl-3-methylsulfonylguanidine (PubChem CID 88701159) has the molecular formula C18H31N7O7S2 and a molecular weight of 521.62 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-[4-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]-2-methyl-3-methylsulfonylguanidine.
| Compound Name | (Z)-but-2-enedioic acid;1-[4-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]-2-methyl-3-methylsulfonylguanidine |
|---|---|
| PubChem CID | 88701159 |
| Molecular Formula | C18H31N7O7S2 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.17 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-[4-[2-[[N'-(2-methoxyethyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]butyl]-2-methyl-3-methylsulfonylguanidine |
| SMILES | C/N=C(/NCCCCc1csc(N/C(N)=N/CCOC)n1)NS(C)(=O)=O.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C14H27N7O3S2.C4H4O4/c1-16-13(21-26(3,22)23)18-7-5-4-6-11-10-25-14(19-11)20-12(15)17-8-9-24-2;5-3(6)1-2-4(7)8/h10H,4-9H2,1-3H3,(H2,16,18,21)(H3,15,17,19,20);1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | ODUNPMWLAAFZHI-BTJKTKAUSA-N |
| XLogP | -0.32 |
| TPSA | 217.69 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|