C14H25N5OS — CID 139707671
N-[3-[2-[[N'-(3-methylbutyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]propyl]acetamide (PubChem CID 139707671) has the molecular formula C14H25N5OS and a molecular weight of 311.46 g/mol. Its IUPAC name is N-[3-[2-[[N'-(3-methylbutyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]propyl]acetamide.
| Compound Name | N-[3-[2-[[N'-(3-methylbutyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]propyl]acetamide |
|---|---|
| PubChem CID | 139707671 |
| Molecular Formula | C14H25N5OS |
| Molecular Weight | 311.46 g/mol |
| Exact Mass | 311.18 |
| IUPAC Name | N-[3-[2-[[N'-(3-methylbutyl)carbamimidoyl]amino]-1,3-thiazol-4-yl]propyl]acetamide |
| SMILES | CC(=O)NCCCc1csc(N/C(N)=N/CCC(C)C)n1 |
| InChI | InChI=1S/C14H25N5OS/c1-10(2)6-8-17-13(15)19-14-18-12(9-21-14)5-4-7-16-11(3)20/h9-10H,4-8H2,1-3H3,(H,16,20)(H3,15,17,18,19) |
| InChIKey | SVORWWFSMLGCCY-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 92.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.46 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|