C18H22N4O3S — CID 87597745
2-[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]phenyl]ethyliminomethylcarbamic acid (PubChem CID 87597745) has the molecular formula C18H22N4O3S and a molecular weight of 374.47 g/mol. Its IUPAC name is 2-[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]phenyl]ethyliminomethylcarbamic acid.
| Compound Name | 2-[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]phenyl]ethyliminomethylcarbamic acid |
|---|---|
| PubChem CID | 87597745 |
| Molecular Formula | C18H22N4O3S |
| Molecular Weight | 374.47 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 2-[4-[3-(2-acetamido-1,3-thiazol-4-yl)propyl]phenyl]ethyliminomethylcarbamic acid |
| SMILES | CC(=O)Nc1nc(CCCc2ccc(CC/N=C/NC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C18H22N4O3S/c1-13(23)21-17-22-16(11-26-17)4-2-3-14-5-7-15(8-6-14)9-10-19-12-20-18(24)25/h5-8,11-12H,2-4,9-10H2,1H3,(H,19,20)(H,24,25)(H,21,22,23) |
| InChIKey | RBCZUIIBHGDJKE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|