C15H16N4O3S — CID 87741097
2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethyliminomethylcarbamic acid (PubChem CID 87741097) has the molecular formula C15H16N4O3S and a molecular weight of 332.39 g/mol. Its IUPAC name is 2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethyliminomethylcarbamic acid.
| Compound Name | 2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethyliminomethylcarbamic acid |
|---|---|
| PubChem CID | 87741097 |
| Molecular Formula | C15H16N4O3S |
| Molecular Weight | 332.39 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[4-(2-acetamido-1,3-thiazol-4-yl)phenyl]ethyliminomethylcarbamic acid |
| SMILES | CC(=O)Nc1nc(-c2ccc(CC/N=C/NC(=O)O)cc2)cs1 |
| InChI | InChI=1S/C15H16N4O3S/c1-10(20)18-14-19-13(8-23-14)12-4-2-11(3-5-12)6-7-16-9-17-15(21)22/h2-5,8-9H,6-7H2,1H3,(H,16,17)(H,21,22)(H,18,19,20) |
| InChIKey | ADBHWMXAOXYBNN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.39 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|