C27H31N3O3S2 — CID 163270016
S-[7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl] 3-(4-acetamidophenyl)propanethioate (PubChem CID 163270016) has the molecular formula C27H31N3O3S2 and a molecular weight of 509.70 g/mol. Its IUPAC name is S-[7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl] 3-(4-acetamidophenyl)propanethioate.
| Compound Name | S-[7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl] 3-(4-acetamidophenyl)propanethioate |
|---|---|
| PubChem CID | 163270016 |
| Molecular Formula | C27H31N3O3S2 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | S-[7-oxo-7-[(4-phenyl-1,3-thiazol-2-yl)amino]heptyl] 3-(4-acetamidophenyl)propanethioate |
| SMILES | CC(=O)Nc1ccc(CCC(=O)SCCCCCCC(=O)Nc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C27H31N3O3S2/c1-20(31)28-23-15-12-21(13-16-23)14-17-26(33)34-18-8-3-2-7-11-25(32)30-27-29-24(19-35-27)22-9-5-4-6-10-22/h4-6,9-10,12-13,15-16,19H,2-3,7-8,11,14,17-18H2,1H3,(H,28,31)(H,29,30,32) |
| InChIKey | AOTJASQUDGYRJR-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 88.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|