C25H28N4O3S — CID 108739753
N-[6-[[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-6-oxohexyl]benzamide (PubChem CID 108739753) has the molecular formula C25H28N4O3S and a molecular weight of 464.59 g/mol. Its IUPAC name is N-[6-[[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-6-oxohexyl]benzamide.
| Compound Name | N-[6-[[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-6-oxohexyl]benzamide |
|---|---|
| PubChem CID | 108739753 |
| Molecular Formula | C25H28N4O3S |
| Molecular Weight | 464.59 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | N-[6-[[4-[4-(acetamidomethyl)phenyl]-1,3-thiazol-2-yl]amino]-6-oxohexyl]benzamide |
| SMILES | CC(=O)NCc1ccc(-c2csc(NC(=O)CCCCCNC(=O)c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C25H28N4O3S/c1-18(30)27-16-19-11-13-20(14-12-19)22-17-33-25(28-22)29-23(31)10-6-3-7-15-26-24(32)21-8-4-2-5-9-21/h2,4-5,8-9,11-14,17H,3,6-7,10,15-16H2,1H3,(H,26,32)(H,27,30)(H,28,29,31) |
| InChIKey | UOKRYIRIKXJNRG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.59 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|